C26H36N4O4 — CID 3836869
2-[1-[(2-ethoxyphenyl)carbamoyl]piperidin-4-yl]-6-methyl-N-(2-propoxyethyl)pyridine-3-carboxamide (PubChem CID 3836869) has the molecular formula C26H36N4O4 and a molecular weight of 468.60 g/mol. Its IUPAC name is 2-[1-[(2-ethoxyphenyl)carbamoyl]piperidin-4-yl]-6-methyl-N-(2-propoxyethyl)pyridine-3-carboxamide.
| Compound Name | 2-[1-[(2-ethoxyphenyl)carbamoyl]piperidin-4-yl]-6-methyl-N-(2-propoxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3836869 |
| Molecular Formula | C26H36N4O4 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | 2-[1-[(2-ethoxyphenyl)carbamoyl]piperidin-4-yl]-6-methyl-N-(2-propoxyethyl)pyridine-3-carboxamide |
| SMILES | CCCOCCNC(=O)c1ccc(C)nc1C1CCN(C(=O)Nc2ccccc2OCC)CC1 |
| InChI | InChI=1S/C26H36N4O4/c1-4-17-33-18-14-27-25(31)21-11-10-19(3)28-24(21)20-12-15-30(16-13-20)26(32)29-22-8-6-7-9-23(22)34-5-2/h6-11,20H,4-5,12-18H2,1-3H3,(H,27,31)(H,29,32) |
| InChIKey | ADBWCKRTQANUGP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|