C28H42N4O3 — CID 3267670
2-[1-(1-adamantylcarbamoyl)piperidin-4-yl]-6-methyl-N-(2-propoxyethyl)pyridine-3-carboxamide (PubChem CID 3267670) has the molecular formula C28H42N4O3 and a molecular weight of 482.67 g/mol. Its IUPAC name is 2-[1-(1-adamantylcarbamoyl)piperidin-4-yl]-6-methyl-N-(2-propoxyethyl)pyridine-3-carboxamide.
| Compound Name | 2-[1-(1-adamantylcarbamoyl)piperidin-4-yl]-6-methyl-N-(2-propoxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3267670 |
| Molecular Formula | C28H42N4O3 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.33 |
| IUPAC Name | 2-[1-(1-adamantylcarbamoyl)piperidin-4-yl]-6-methyl-N-(2-propoxyethyl)pyridine-3-carboxamide |
| SMILES | CCCOCCNC(=O)c1ccc(C)nc1C1CCN(C(=O)NC23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C28H42N4O3/c1-3-11-35-12-8-29-26(33)24-5-4-19(2)30-25(24)23-6-9-32(10-7-23)27(34)31-28-16-20-13-21(17-28)15-22(14-20)18-28/h4-5,20-23H,3,6-18H2,1-2H3,(H,29,33)(H,31,34) |
| InChIKey | CTJNKRMWBMMNOI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|