C25H34N4O5 — CID 3864511
2-[1-(2,6-dimethoxypyridine-3-carbonyl)piperidin-4-yl]-6-methyl-N-(2-propoxyethyl)pyridine-3-carboxamide (PubChem CID 3864511) has the molecular formula C25H34N4O5 and a molecular weight of 470.57 g/mol. Its IUPAC name is 2-[1-(2,6-dimethoxypyridine-3-carbonyl)piperidin-4-yl]-6-methyl-N-(2-propoxyethyl)pyridine-3-carboxamide.
| Compound Name | 2-[1-(2,6-dimethoxypyridine-3-carbonyl)piperidin-4-yl]-6-methyl-N-(2-propoxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3864511 |
| Molecular Formula | C25H34N4O5 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 2-[1-(2,6-dimethoxypyridine-3-carbonyl)piperidin-4-yl]-6-methyl-N-(2-propoxyethyl)pyridine-3-carboxamide |
| SMILES | CCCOCCNC(=O)c1ccc(C)nc1C1CCN(C(=O)c2ccc(OC)nc2OC)CC1 |
| InChI | InChI=1S/C25H34N4O5/c1-5-15-34-16-12-26-23(30)19-7-6-17(2)27-22(19)18-10-13-29(14-11-18)25(31)20-8-9-21(32-3)28-24(20)33-4/h6-9,18H,5,10-16H2,1-4H3,(H,26,30) |
| InChIKey | QKURDDDZKDFDSM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 102.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|