C26H35N5O4 — CID 3762431
6-methyl-2-[1-[2-(phenylcarbamoylamino)acetyl]piperidin-4-yl]-N-(2-propoxyethyl)pyridine-3-carboxamide (PubChem CID 3762431) has the molecular formula C26H35N5O4 and a molecular weight of 481.60 g/mol. Its IUPAC name is 6-methyl-2-[1-[2-(phenylcarbamoylamino)acetyl]piperidin-4-yl]-N-(2-propoxyethyl)pyridine-3-carboxamide.
| Compound Name | 6-methyl-2-[1-[2-(phenylcarbamoylamino)acetyl]piperidin-4-yl]-N-(2-propoxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3762431 |
| Molecular Formula | C26H35N5O4 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | 6-methyl-2-[1-[2-(phenylcarbamoylamino)acetyl]piperidin-4-yl]-N-(2-propoxyethyl)pyridine-3-carboxamide |
| SMILES | CCCOCCNC(=O)c1ccc(C)nc1C1CCN(C(=O)CNC(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C26H35N5O4/c1-3-16-35-17-13-27-25(33)22-10-9-19(2)29-24(22)20-11-14-31(15-12-20)23(32)18-28-26(34)30-21-7-5-4-6-8-21/h4-10,20H,3,11-18H2,1-2H3,(H,27,33)(H2,28,30,34) |
| InChIKey | KXCJEXTWYOIKMW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|