C25H33N5O2 — CID 3470783
2-[1-(cyclohex-3-ene-1-carbonyl)piperidin-4-yl]-N-(3-imidazol-1-ylpropyl)-6-methylpyridine-3-carboxamide (PubChem CID 3470783) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 2-[1-(cyclohex-3-ene-1-carbonyl)piperidin-4-yl]-N-(3-imidazol-1-ylpropyl)-6-methylpyridine-3-carboxamide.
| Compound Name | 2-[1-(cyclohex-3-ene-1-carbonyl)piperidin-4-yl]-N-(3-imidazol-1-ylpropyl)-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 3470783 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 2-[1-(cyclohex-3-ene-1-carbonyl)piperidin-4-yl]-N-(3-imidazol-1-ylpropyl)-6-methylpyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCCn2ccnc2)c(C2CCN(C(=O)C3CC=CCC3)CC2)n1 |
| InChI | InChI=1S/C25H33N5O2/c1-19-8-9-22(24(31)27-12-5-14-29-17-13-26-18-29)23(28-19)20-10-15-30(16-11-20)25(32)21-6-3-2-4-7-21/h2-3,8-9,13,17-18,20-21H,4-7,10-12,14-16H2,1H3,(H,27,31) |
| InChIKey | JYUFDZPEJJSFSZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|