C26H30N6O4 — CID 3787919
N-(3-imidazol-1-ylpropyl)-6-methyl-2-[1-(2-methyl-5-nitrobenzoyl)piperidin-4-yl]pyridine-3-carboxamide (PubChem CID 3787919) has the molecular formula C26H30N6O4 and a molecular weight of 490.56 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-6-methyl-2-[1-(2-methyl-5-nitrobenzoyl)piperidin-4-yl]pyridine-3-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-6-methyl-2-[1-(2-methyl-5-nitrobenzoyl)piperidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3787919 |
| Molecular Formula | C26H30N6O4 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-6-methyl-2-[1-(2-methyl-5-nitrobenzoyl)piperidin-4-yl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCCn2ccnc2)c(C2CCN(C(=O)c3cc([N+](=O)[O-])ccc3C)CC2)n1 |
| InChI | InChI=1S/C26H30N6O4/c1-18-4-6-21(32(35)36)16-23(18)26(34)31-13-8-20(9-14-31)24-22(7-5-19(2)29-24)25(33)28-10-3-12-30-15-11-27-17-30/h4-7,11,15-17,20H,3,8-10,12-14H2,1-2H3,(H,28,33) |
| InChIKey | FKBVAYQCDBWUEO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 123.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|