C27H27N7O4 — CID 3332179
N-(4-imidazol-1-ylphenyl)-6-methyl-2-[1-(1-methyl-4-nitropyrrole-2-carbonyl)piperidin-4-yl]pyridine-3-carboxamide (PubChem CID 3332179) has the molecular formula C27H27N7O4 and a molecular weight of 513.56 g/mol. Its IUPAC name is N-(4-imidazol-1-ylphenyl)-6-methyl-2-[1-(1-methyl-4-nitropyrrole-2-carbonyl)piperidin-4-yl]pyridine-3-carboxamide.
| Compound Name | N-(4-imidazol-1-ylphenyl)-6-methyl-2-[1-(1-methyl-4-nitropyrrole-2-carbonyl)piperidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3332179 |
| Molecular Formula | C27H27N7O4 |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | N-(4-imidazol-1-ylphenyl)-6-methyl-2-[1-(1-methyl-4-nitropyrrole-2-carbonyl)piperidin-4-yl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(-n3ccnc3)cc2)c(C2CCN(C(=O)c3cc([N+](=O)[O-])cn3C)CC2)n1 |
| InChI | InChI=1S/C27H27N7O4/c1-18-3-8-23(26(35)30-20-4-6-21(7-5-20)33-14-11-28-17-33)25(29-18)19-9-12-32(13-10-19)27(36)24-15-22(34(37)38)16-31(24)2/h3-8,11,14-17,19H,9-10,12-13H2,1-2H3,(H,30,35) |
| InChIKey | KVQPQAMGFULRTQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 128.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|