C15H16FN3O3S — CID 75378460
N-(1,1-dioxothian-4-yl)-5-(2-fluorophenyl)-1H-pyrazole-4-carboxamide (PubChem CID 75378460) has the molecular formula C15H16FN3O3S and a molecular weight of 337.38 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-5-(2-fluorophenyl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-(1,1-dioxothian-4-yl)-5-(2-fluorophenyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 75378460 |
| Molecular Formula | C15H16FN3O3S |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-5-(2-fluorophenyl)-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)CC1)c1cn[nH]c1-c1ccccc1F |
| InChI | InChI=1S/C15H16FN3O3S/c16-13-4-2-1-3-11(13)14-12(9-17-19-14)15(20)18-10-5-7-23(21,22)8-6-10/h1-4,9-10H,5-8H2,(H,17,19)(H,18,20) |
| InChIKey | FBUYTUYKHRIQSG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |