C15H17N3O3S — CID 60511818
N-(1,1-dioxothian-4-yl)-5-phenyl-1H-pyrazole-4-carboxamide (PubChem CID 60511818) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-5-phenyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-(1,1-dioxothian-4-yl)-5-phenyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 60511818 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-5-phenyl-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)CC1)c1cn[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C15H17N3O3S/c19-15(17-12-6-8-22(20,21)9-7-12)13-10-16-18-14(13)11-4-2-1-3-5-11/h1-5,10,12H,6-9H2,(H,16,18)(H,17,19) |
| InChIKey | ZSIRCLBBZMZRHD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |