C16H21ClN4O — CID 119475103
N-(4-aminocyclohexyl)-5-phenyl-1H-pyrazole-4-carboxamide;hydrochloride (PubChem CID 119475103) has the molecular formula C16H21ClN4O and a molecular weight of 320.82 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-5-phenyl-1H-pyrazole-4-carboxamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-5-phenyl-1H-pyrazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119475103 |
| Molecular Formula | C16H21ClN4O |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | N-(4-aminocyclohexyl)-5-phenyl-1H-pyrazole-4-carboxamide;hydrochloride |
| SMILES | Cl.NC1CCC(NC(=O)c2cn[nH]c2-c2ccccc2)CC1 |
| InChI | InChI=1S/C16H20N4O.ClH/c17-12-6-8-13(9-7-12)19-16(21)14-10-18-20-15(14)11-4-2-1-3-5-11;/h1-5,10,12-13H,6-9,17H2,(H,18,20)(H,19,21);1H |
| InChIKey | KFHCBZQXUWRPAG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |