C19H23ClN2OS — CID 119478534
N-(4-aminocyclohexyl)-2-phenylsulfanylbenzamide;hydrochloride (PubChem CID 119478534) has the molecular formula C19H23ClN2OS and a molecular weight of 362.93 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-2-phenylsulfanylbenzamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-2-phenylsulfanylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119478534 |
| Molecular Formula | C19H23ClN2OS |
| Molecular Weight | 362.93 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N-(4-aminocyclohexyl)-2-phenylsulfanylbenzamide;hydrochloride |
| SMILES | Cl.NC1CCC(NC(=O)c2ccccc2Sc2ccccc2)CC1 |
| InChI | InChI=1S/C19H22N2OS.ClH/c20-14-10-12-15(13-11-14)21-19(22)17-8-4-5-9-18(17)23-16-6-2-1-3-7-16;/h1-9,14-15H,10-13,20H2,(H,21,22);1H |
| InChIKey | BZVSNABXYPXCGI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.93 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |