C13H12N4O3 — CID 71824219
N-cyclopropyl-5-(4-nitrophenyl)-1H-pyrazole-4-carboxamide (PubChem CID 71824219) has the molecular formula C13H12N4O3 and a molecular weight of 272.26 g/mol. Its IUPAC name is N-cyclopropyl-5-(4-nitrophenyl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-cyclopropyl-5-(4-nitrophenyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 71824219 |
| Molecular Formula | C13H12N4O3 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | N-cyclopropyl-5-(4-nitrophenyl)-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NC1CC1)c1cn[nH]c1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H12N4O3/c18-13(15-9-3-4-9)11-7-14-16-12(11)8-1-5-10(6-2-8)17(19)20/h1-2,5-7,9H,3-4H2,(H,14,16)(H,15,18) |
| InChIKey | KTWHASUWNAJJAB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|