C11H13FN2O3S — CID 115646668
N-(1,1-dioxothian-4-yl)-3-fluoropyridine-4-carboxamide (PubChem CID 115646668) has the molecular formula C11H13FN2O3S and a molecular weight of 272.30 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-3-fluoropyridine-4-carboxamide.
| Compound Name | N-(1,1-dioxothian-4-yl)-3-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 115646668 |
| Molecular Formula | C11H13FN2O3S |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-3-fluoropyridine-4-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)CC1)c1ccncc1F |
| InChI | InChI=1S/C11H13FN2O3S/c12-10-7-13-4-1-9(10)11(15)14-8-2-5-18(16,17)6-3-8/h1,4,7-8H,2-3,5-6H2,(H,14,15) |
| InChIKey | ODTDPNPCQCJQHD-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |