C13H16FN3O2 — CID 113240920
N-(1-acetylpiperidin-4-yl)-3-fluoropyridine-4-carboxamide (PubChem CID 113240920) has the molecular formula C13H16FN3O2 and a molecular weight of 265.29 g/mol. Its IUPAC name is N-(1-acetylpiperidin-4-yl)-3-fluoropyridine-4-carboxamide.
| Compound Name | N-(1-acetylpiperidin-4-yl)-3-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 113240920 |
| Molecular Formula | C13H16FN3O2 |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | N-(1-acetylpiperidin-4-yl)-3-fluoropyridine-4-carboxamide |
| SMILES | CC(=O)N1CCC(NC(=O)c2ccncc2F)CC1 |
| InChI | InChI=1S/C13H16FN3O2/c1-9(18)17-6-3-10(4-7-17)16-13(19)11-2-5-15-8-12(11)14/h2,5,8,10H,3-4,6-7H2,1H3,(H,16,19) |
| InChIKey | YUBAYXSPENHVFU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |