C17H21FN5O3+ — CID 167997054
N-[1-(1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-yl)piperidin-4-yl]-3-fluoropyridine-4-carboxamide (PubChem CID 167997054) has the molecular formula C17H21FN5O3+ and a molecular weight of 362.39 g/mol. Its IUPAC name is N-[1-(1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-yl)piperidin-4-yl]-3-fluoropyridine-4-carboxamide.
| Compound Name | N-[1-(1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-yl)piperidin-4-yl]-3-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 167997054 |
| Molecular Formula | C17H21FN5O3+ |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-[1-(1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-yl)piperidin-4-yl]-3-fluoropyridine-4-carboxamide |
| SMILES | CN1C(=O)C(N2CCC(NC(=O)c3ccncc3F)CC2)C=[N+](C)C1=O |
| InChI | InChI=1S/C17H20FN5O3/c1-21-10-14(16(25)22(2)17(21)26)23-7-4-11(5-8-23)20-15(24)12-3-6-19-9-13(12)18/h3,6,9-11,14H,4-5,7-8H2,1-2H3/p+1 |
| InChIKey | NCMWFNLXPXCLID-UHFFFAOYSA-O |
| XLogP | 0.09 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|