C21H26N5O4+ — CID 167997146
N-[1-(1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-yl)piperidin-4-yl]-6-methoxy-1H-indole-2-carboxamide (PubChem CID 167997146) has the molecular formula C21H26N5O4+ and a molecular weight of 412.47 g/mol. Its IUPAC name is N-[1-(1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-yl)piperidin-4-yl]-6-methoxy-1H-indole-2-carboxamide.
| Compound Name | N-[1-(1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-yl)piperidin-4-yl]-6-methoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167997146 |
| Molecular Formula | C21H26N5O4+ |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | N-[1-(1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-yl)piperidin-4-yl]-6-methoxy-1H-indole-2-carboxamide |
| SMILES | COc1ccc2cc(C(=O)NC3CCN(C4C=[N+](C)C(=O)N(C)C4=O)CC3)[nH]c2c1 |
| InChI | InChI=1S/C21H25N5O4/c1-24-12-18(20(28)25(2)21(24)29)26-8-6-14(7-9-26)22-19(27)17-10-13-4-5-15(30-3)11-16(13)23-17/h4-5,10-12,14,18H,6-9H2,1-3H3,(H-,22,23,27)/p+1 |
| InChIKey | KIQPJYKMQHEGEJ-UHFFFAOYSA-O |
| XLogP | 1.04 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|