C24H33N3O3 — CID 92503737
(2R)-N-cyclohexyl-2-[1-(6-methoxy-1H-indole-2-carbonyl)piperidin-4-yl]propanamide (PubChem CID 92503737) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-[1-(6-methoxy-1H-indole-2-carbonyl)piperidin-4-yl]propanamide.
| Compound Name | (2R)-N-cyclohexyl-2-[1-(6-methoxy-1H-indole-2-carbonyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 92503737 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | (2R)-N-cyclohexyl-2-[1-(6-methoxy-1H-indole-2-carbonyl)piperidin-4-yl]propanamide |
| SMILES | COc1ccc2cc(C(=O)N3CCC([C@@H](C)C(=O)NC4CCCCC4)CC3)[nH]c2c1 |
| InChI | InChI=1S/C24H33N3O3/c1-16(23(28)25-19-6-4-3-5-7-19)17-10-12-27(13-11-17)24(29)22-14-18-8-9-20(30-2)15-21(18)26-22/h8-9,14-17,19,26H,3-7,10-13H2,1-2H3,(H,25,28)/t16-/m1/s1 |
| InChIKey | AMHBQUMHEYSKEV-MRXNPFEDSA-N |
| XLogP | 4.11 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |