C26H39N5O3 — CID 92765247
(2S)-2-[1-(6-methoxy-1H-indole-2-carbonyl)piperidin-4-yl]-N-[3-(4-methylpiperazin-1-yl)propyl]propanamide (PubChem CID 92765247) has the molecular formula C26H39N5O3 and a molecular weight of 469.63 g/mol. Its IUPAC name is (2S)-2-[1-(6-methoxy-1H-indole-2-carbonyl)piperidin-4-yl]-N-[3-(4-methylpiperazin-1-yl)propyl]propanamide.
| Compound Name | (2S)-2-[1-(6-methoxy-1H-indole-2-carbonyl)piperidin-4-yl]-N-[3-(4-methylpiperazin-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 92765247 |
| Molecular Formula | C26H39N5O3 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.31 |
| IUPAC Name | (2S)-2-[1-(6-methoxy-1H-indole-2-carbonyl)piperidin-4-yl]-N-[3-(4-methylpiperazin-1-yl)propyl]propanamide |
| SMILES | COc1ccc2cc(C(=O)N3CCC([C@H](C)C(=O)NCCCN4CCN(C)CC4)CC3)[nH]c2c1 |
| InChI | InChI=1S/C26H39N5O3/c1-19(25(32)27-9-4-10-30-15-13-29(2)14-16-30)20-7-11-31(12-8-20)26(33)24-17-21-5-6-22(34-3)18-23(21)28-24/h5-6,17-20,28H,4,7-16H2,1-3H3,(H,27,32)/t19-/m0/s1 |
| InChIKey | OGBHJQGESYWXBM-IBGZPJMESA-N |
| XLogP | 2.42 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|