C19H23N3O5 — CID 34506263
[2-(cyclohexylcarbamoylamino)-2-oxoethyl] 6-methoxy-1H-indole-2-carboxylate (PubChem CID 34506263) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 6-methoxy-1H-indole-2-carboxylate.
| Compound Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 6-methoxy-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 34506263 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 6-methoxy-1H-indole-2-carboxylate |
| SMILES | COc1ccc2cc(C(=O)OCC(=O)NC(=O)NC3CCCCC3)[nH]c2c1 |
| InChI | InChI=1S/C19H23N3O5/c1-26-14-8-7-12-9-16(21-15(12)10-14)18(24)27-11-17(23)22-19(25)20-13-5-3-2-4-6-13/h7-10,13,21H,2-6,11H2,1H3,(H2,20,22,23,25) |
| InChIKey | UHRRBUVNHAMXGT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |