C18H21N3O4 — CID 7722844
[2-(cyclohexylcarbamoylamino)-2-oxoethyl] 1H-indole-2-carboxylate (PubChem CID 7722844) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 1H-indole-2-carboxylate.
| Compound Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 7722844 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 1H-indole-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc2ccccc2[nH]1)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H21N3O4/c22-16(21-18(24)19-13-7-2-1-3-8-13)11-25-17(23)15-10-12-6-4-5-9-14(12)20-15/h4-6,9-10,13,20H,1-3,7-8,11H2,(H2,19,21,22,24) |
| InChIKey | ZRPPBEIHSVRKRQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |