C22H31N4O3+ — CID 167997003
4-tert-butyl-N-[1-(1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-yl)piperidin-4-yl]benzamide (PubChem CID 167997003) has the molecular formula C22H31N4O3+ and a molecular weight of 399.52 g/mol. Its IUPAC name is 4-tert-butyl-N-[1-(1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-yl)piperidin-4-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[1-(1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-yl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 167997003 |
| Molecular Formula | C22H31N4O3+ |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | 4-tert-butyl-N-[1-(1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-yl)piperidin-4-yl]benzamide |
| SMILES | CN1C(=O)C(N2CCC(NC(=O)c3ccc(C(C)(C)C)cc3)CC2)C=[N+](C)C1=O |
| InChI | InChI=1S/C22H30N4O3/c1-22(2,3)16-8-6-15(7-9-16)19(27)23-17-10-12-26(13-11-17)18-14-24(4)21(29)25(5)20(18)28/h6-9,14,17-18H,10-13H2,1-5H3/p+1 |
| InChIKey | SYRYVCLGRPRXOI-UHFFFAOYSA-O |
| XLogP | 1.85 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|