C11H16Cl2FN3O — CID 117073389
3-fluoro-N-piperidin-4-ylpyridine-4-carboxamide;dihydrochloride (PubChem CID 117073389) has the molecular formula C11H16Cl2FN3O and a molecular weight of 296.17 g/mol. Its IUPAC name is 3-fluoro-N-piperidin-4-ylpyridine-4-carboxamide;dihydrochloride.
| Compound Name | 3-fluoro-N-piperidin-4-ylpyridine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 117073389 |
| Molecular Formula | C11H16Cl2FN3O |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 3-fluoro-N-piperidin-4-ylpyridine-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NC1CCNCC1)c1ccncc1F |
| InChI | InChI=1S/C11H14FN3O.2ClH/c12-10-7-14-6-3-9(10)11(16)15-8-1-4-13-5-2-8;;/h3,6-8,13H,1-2,4-5H2,(H,15,16);2*1H |
| InChIKey | SXHSDCRFAWAIBB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |