C10H14Cl3N3O — CID 119452044
3-chloro-N-pyrrolidin-3-ylpyridine-4-carboxamide;dihydrochloride (PubChem CID 119452044) has the molecular formula C10H14Cl3N3O and a molecular weight of 298.60 g/mol. Its IUPAC name is 3-chloro-N-pyrrolidin-3-ylpyridine-4-carboxamide;dihydrochloride.
| Compound Name | 3-chloro-N-pyrrolidin-3-ylpyridine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119452044 |
| Molecular Formula | C10H14Cl3N3O |
| Molecular Weight | 298.60 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | 3-chloro-N-pyrrolidin-3-ylpyridine-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NC1CCNC1)c1ccncc1Cl |
| InChI | InChI=1S/C10H12ClN3O.2ClH/c11-9-6-13-4-2-8(9)10(15)14-7-1-3-12-5-7;;/h2,4,6-7,12H,1,3,5H2,(H,14,15);2*1H |
| InChIKey | OZCVMZVKVNEJMS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.60 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |