C14H19ClN2O — CID 66482604
3-chloro-N-(3,5-dimethylcyclohexyl)pyridine-4-carboxamide (PubChem CID 66482604) has the molecular formula C14H19ClN2O and a molecular weight of 266.77 g/mol. Its IUPAC name is 3-chloro-N-(3,5-dimethylcyclohexyl)pyridine-4-carboxamide.
| Compound Name | 3-chloro-N-(3,5-dimethylcyclohexyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 66482604 |
| Molecular Formula | C14H19ClN2O |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 3-chloro-N-(3,5-dimethylcyclohexyl)pyridine-4-carboxamide |
| SMILES | CC1CC(C)CC(NC(=O)c2ccncc2Cl)C1 |
| InChI | InChI=1S/C14H19ClN2O/c1-9-5-10(2)7-11(6-9)17-14(18)12-3-4-16-8-13(12)15/h3-4,8-11H,5-7H2,1-2H3,(H,17,18) |
| InChIKey | WGJOFBDMUUTEOA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |