C13H16FN3O2 — CID 115646353
N-[4-(cyclopropylamino)-4-oxobutyl]-3-fluoropyridine-4-carboxamide (PubChem CID 115646353) has the molecular formula C13H16FN3O2 and a molecular weight of 265.29 g/mol. Its IUPAC name is N-[4-(cyclopropylamino)-4-oxobutyl]-3-fluoropyridine-4-carboxamide.
| Compound Name | N-[4-(cyclopropylamino)-4-oxobutyl]-3-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 115646353 |
| Molecular Formula | C13H16FN3O2 |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | N-[4-(cyclopropylamino)-4-oxobutyl]-3-fluoropyridine-4-carboxamide |
| SMILES | O=C(CCCNC(=O)c1ccncc1F)NC1CC1 |
| InChI | InChI=1S/C13H16FN3O2/c14-11-8-15-7-5-10(11)13(19)16-6-1-2-12(18)17-9-3-4-9/h5,7-9H,1-4,6H2,(H,16,19)(H,17,18) |
| InChIKey | KIAWOUCFMOGXSQ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|