C18H15ClFN3O2 — CID 155949629
5-(3-chlorophenyl)-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-1H-pyrazole-4-carboxamide (PubChem CID 155949629) has the molecular formula C18H15ClFN3O2 and a molecular weight of 359.79 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(3-chlorophenyl)-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 155949629 |
| Molecular Formula | C18H15ClFN3O2 |
| Molecular Weight | 359.79 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 5-(3-chlorophenyl)-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NCC(O)c1ccc(F)cc1)c1cn[nH]c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H15ClFN3O2/c19-13-3-1-2-12(8-13)17-15(9-22-23-17)18(25)21-10-16(24)11-4-6-14(20)7-5-11/h1-9,16,24H,10H2,(H,21,25)(H,22,23) |
| InChIKey | MJWRJRDVMHACBI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.79 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |