C14H16ClN3O2S — CID 75425510
5-(3-chlorophenyl)-N-(3-methylsulfinylpropyl)-1H-pyrazole-4-carboxamide (PubChem CID 75425510) has the molecular formula C14H16ClN3O2S and a molecular weight of 325.82 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-N-(3-methylsulfinylpropyl)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(3-chlorophenyl)-N-(3-methylsulfinylpropyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 75425510 |
| Molecular Formula | C14H16ClN3O2S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 5-(3-chlorophenyl)-N-(3-methylsulfinylpropyl)-1H-pyrazole-4-carboxamide |
| SMILES | CS(=O)CCCNC(=O)c1cn[nH]c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H16ClN3O2S/c1-21(20)7-3-6-16-14(19)12-9-17-18-13(12)10-4-2-5-11(15)8-10/h2,4-5,8-9H,3,6-7H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | ABDGRUKKFPNYHX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|