C14H13ClN2O3 — CID 138042614
N-[(2S)-2-(4-chlorophenyl)-2-hydroxyethyl]-2-oxo-1H-pyridine-4-carboxamide (PubChem CID 138042614) has the molecular formula C14H13ClN2O3 and a molecular weight of 292.72 g/mol. Its IUPAC name is N-[(2S)-2-(4-chlorophenyl)-2-hydroxyethyl]-2-oxo-1H-pyridine-4-carboxamide.
| Compound Name | N-[(2S)-2-(4-chlorophenyl)-2-hydroxyethyl]-2-oxo-1H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 138042614 |
| Molecular Formula | C14H13ClN2O3 |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | N-[(2S)-2-(4-chlorophenyl)-2-hydroxyethyl]-2-oxo-1H-pyridine-4-carboxamide |
| SMILES | O=C(NC[C@@H](O)c1ccc(Cl)cc1)c1cc[nH]c(=O)c1 |
| InChI | InChI=1S/C14H13ClN2O3/c15-11-3-1-9(2-4-11)12(18)8-17-14(20)10-5-6-16-13(19)7-10/h1-7,12,18H,8H2,(H,16,19)(H,17,20)/t12-/m1/s1 |
| InChIKey | ATKHIJYZKCQHNF-GFCCVEGCSA-N |
| XLogP | 1.49 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |