C16H16ClNO4S — CID 47022574
N-[2-(4-chlorophenyl)-2-hydroxyethyl]-4-methylsulfonylbenzamide (PubChem CID 47022574) has the molecular formula C16H16ClNO4S and a molecular weight of 353.83 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-hydroxyethyl]-4-methylsulfonylbenzamide.
| Compound Name | N-[2-(4-chlorophenyl)-2-hydroxyethyl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 47022574 |
| Molecular Formula | C16H16ClNO4S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-hydroxyethyl]-4-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)NCC(O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H16ClNO4S/c1-23(21,22)14-8-4-12(5-9-14)16(20)18-10-15(19)11-2-6-13(17)7-3-11/h2-9,15,19H,10H2,1H3,(H,18,20) |
| InChIKey | VLYCYHHTPIXEDK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |