C11H14ClNO5S — CID 134298683
2-chloro-2-hydroxy-N-[(2R)-2-hydroxy-2-(4-methylsulfonylphenyl)ethyl]acetamide (PubChem CID 134298683) has the molecular formula C11H14ClNO5S and a molecular weight of 307.76 g/mol. Its IUPAC name is 2-chloro-2-hydroxy-N-[(2R)-2-hydroxy-2-(4-methylsulfonylphenyl)ethyl]acetamide.
| Compound Name | 2-chloro-2-hydroxy-N-[(2R)-2-hydroxy-2-(4-methylsulfonylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 134298683 |
| Molecular Formula | C11H14ClNO5S |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 2-chloro-2-hydroxy-N-[(2R)-2-hydroxy-2-(4-methylsulfonylphenyl)ethyl]acetamide |
| SMILES | CS(=O)(=O)c1ccc([C@@H](O)CNC(=O)C(O)Cl)cc1 |
| InChI | InChI=1S/C11H14ClNO5S/c1-19(17,18)8-4-2-7(3-5-8)9(14)6-13-11(16)10(12)15/h2-5,9-10,14-15H,6H2,1H3,(H,13,16)/t9-,10?/m0/s1 |
| InChIKey | ZPKPYAGISWNUPX-RGURZIINSA-N |
| XLogP | -0.20 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|