C15H26N4O2 — CID 86984951
N-[2-(diethylamino)-4-methylpentyl]-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 86984951) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is N-[2-(diethylamino)-4-methylpentyl]-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-[2-(diethylamino)-4-methylpentyl]-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 86984951 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | N-[2-(diethylamino)-4-methylpentyl]-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | CCN(CC)C(CNC(=O)c1ccc(=O)[nH]n1)CC(C)C |
| InChI | InChI=1S/C15H26N4O2/c1-5-19(6-2)12(9-11(3)4)10-16-15(21)13-7-8-14(20)18-17-13/h7-8,11-12H,5-6,9-10H2,1-4H3,(H,16,21)(H,18,20) |
| InChIKey | JIYMJMPXDXDIME-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |