C18H23FIN5O — CID 111286012
N-[2-[[N-[(3-fluorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]pyridine-3-carboxamide;hydroiodide (PubChem CID 111286012) has the molecular formula C18H23FIN5O and a molecular weight of 471.32 g/mol. Its IUPAC name is N-[2-[[N-[(3-fluorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]pyridine-3-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N-[(3-fluorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]pyridine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111286012 |
| Molecular Formula | C18H23FIN5O |
| Molecular Weight | 471.32 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | N-[2-[[N-[(3-fluorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]pyridine-3-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)c1cccnc1)N(C)Cc1cccc(F)c1.I |
| InChI | InChI=1S/C18H22FN5O.HI/c1-20-18(24(2)13-14-5-3-7-16(19)11-14)23-10-9-22-17(25)15-6-4-8-21-12-15;/h3-8,11-12H,9-10,13H2,1-2H3,(H,20,23)(H,22,25);1H |
| InChIKey | UEAPZGIAICCNSU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|