C18H21Cl2N5O — CID 111306339
N-[2-[[N-[(3,4-dichlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]pyridine-3-carboxamide (PubChem CID 111306339) has the molecular formula C18H21Cl2N5O and a molecular weight of 394.31 g/mol. Its IUPAC name is N-[2-[[N-[(3,4-dichlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[[N-[(3,4-dichlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 111306339 |
| Molecular Formula | C18H21Cl2N5O |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-[2-[[N-[(3,4-dichlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]pyridine-3-carboxamide |
| SMILES | C/N=C(\NCCNC(=O)c1cccnc1)N(C)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H21Cl2N5O/c1-21-18(25(2)12-13-5-6-15(19)16(20)10-13)24-9-8-23-17(26)14-4-3-7-22-11-14/h3-7,10-11H,8-9,12H2,1-2H3,(H,21,24)(H,23,26) |
| InChIKey | YLQZSQVKPDFKJB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|