C15H22Cl2IN3O2 — CID 111306452
methyl 3-[[N-[(3,4-dichlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]-2-methylpropanoate;hydroiodide (PubChem CID 111306452) has the molecular formula C15H22Cl2IN3O2 and a molecular weight of 474.17 g/mol. Its IUPAC name is methyl 3-[[N-[(3,4-dichlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]-2-methylpropanoate;hydroiodide.
| Compound Name | methyl 3-[[N-[(3,4-dichlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]-2-methylpropanoate;hydroiodide |
|---|---|
| PubChem CID | 111306452 |
| Molecular Formula | C15H22Cl2IN3O2 |
| Molecular Weight | 474.17 g/mol |
| Exact Mass | 473.01 |
| IUPAC Name | methyl 3-[[N-[(3,4-dichlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]-2-methylpropanoate;hydroiodide |
| SMILES | C/N=C(\NCC(C)C(=O)OC)N(C)Cc1ccc(Cl)c(Cl)c1.I |
| InChI | InChI=1S/C15H21Cl2N3O2.HI/c1-10(14(21)22-4)8-19-15(18-2)20(3)9-11-5-6-12(16)13(17)7-11;/h5-7,10H,8-9H2,1-4H3,(H,18,19);1H |
| InChIKey | XOVUKOJZGASGCL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.17 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|