C15H19Cl2IN4S — CID 111306074
1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111306074) has the molecular formula C15H19Cl2IN4S and a molecular weight of 485.22 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111306074 |
| Molecular Formula | C15H19Cl2IN4S |
| Molecular Weight | 485.22 g/mol |
| Exact Mass | 483.98 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1scnc1C)N(C)Cc1ccc(Cl)c(Cl)c1.I |
| InChI | InChI=1S/C15H18Cl2N4S.HI/c1-10-14(22-9-20-10)7-19-15(18-2)21(3)8-11-4-5-12(16)13(17)6-11;/h4-6,9H,7-8H2,1-3H3,(H,18,19);1H |
| InChIKey | MWDBYZDUYMGDMF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.22 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|