C20H22Cl2N6 — CID 111306337
1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine (PubChem CID 111306337) has the molecular formula C20H22Cl2N6 and a molecular weight of 417.34 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111306337 |
| Molecular Formula | C20H22Cl2N6 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(-n2ccnc2C)nc1)N(C)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H22Cl2N6/c1-14-24-8-9-28(14)19-7-5-16(11-25-19)12-26-20(23-2)27(3)13-15-4-6-17(21)18(22)10-15/h4-11H,12-13H2,1-3H3,(H,23,26) |
| InChIKey | QJQCCDBMJNBTRU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|