C21H25ClN6 — CID 111295097
1-[(2-chlorophenyl)methyl]-3-ethyl-1-methyl-2-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine (PubChem CID 111295097) has the molecular formula C21H25ClN6 and a molecular weight of 396.93 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3-ethyl-1-methyl-2-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3-ethyl-1-methyl-2-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111295097 |
| Molecular Formula | C21H25ClN6 |
| Molecular Weight | 396.93 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3-ethyl-1-methyl-2-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(-n2ccnc2C)nc1)N(C)Cc1ccccc1Cl |
| InChI | InChI=1S/C21H25ClN6/c1-4-23-21(27(3)15-18-7-5-6-8-19(18)22)26-14-17-9-10-20(25-13-17)28-12-11-24-16(28)2/h5-13H,4,14-15H2,1-3H3,(H,23,26) |
| InChIKey | YEVOWBVMZYHEEG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.93 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|