C18H24N4O2S — CID 111024333
2-benzyl-1,1-dimethyl-3-[2-(4-sulfamoylphenyl)ethyl]guanidine (PubChem CID 111024333) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is 2-benzyl-1,1-dimethyl-3-[2-(4-sulfamoylphenyl)ethyl]guanidine.
| Compound Name | 2-benzyl-1,1-dimethyl-3-[2-(4-sulfamoylphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111024333 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-benzyl-1,1-dimethyl-3-[2-(4-sulfamoylphenyl)ethyl]guanidine |
| SMILES | CN(C)/C(=N\Cc1ccccc1)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H24N4O2S/c1-22(2)18(21-14-16-6-4-3-5-7-16)20-13-12-15-8-10-17(11-9-15)25(19,23)24/h3-11H,12-14H2,1-2H3,(H,20,21)(H2,19,23,24) |
| InChIKey | AYCAEPATEDOCRD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|