C13H29N3O — CID 111159173
1-butyl-1,2-dimethyl-3-[2-(2-methylpropoxy)ethyl]guanidine (PubChem CID 111159173) has the molecular formula C13H29N3O and a molecular weight of 243.39 g/mol. Its IUPAC name is 1-butyl-1,2-dimethyl-3-[2-(2-methylpropoxy)ethyl]guanidine.
| Compound Name | 1-butyl-1,2-dimethyl-3-[2-(2-methylpropoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 111159173 |
| Molecular Formula | C13H29N3O |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.23 |
| IUPAC Name | 1-butyl-1,2-dimethyl-3-[2-(2-methylpropoxy)ethyl]guanidine |
| SMILES | CCCCN(C)/C(=N/C)NCCOCC(C)C |
| InChI | InChI=1S/C13H29N3O/c1-6-7-9-16(5)13(14-4)15-8-10-17-11-12(2)3/h12H,6-11H2,1-5H3,(H,14,15) |
| InChIKey | HIHFRALVFMQXTE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|