C17H37N3O2S — CID 111573707
1-(2-tert-butylsulfonylethyl)-2-methyl-3-(7-methyloctyl)guanidine (PubChem CID 111573707) has the molecular formula C17H37N3O2S and a molecular weight of 347.57 g/mol. Its IUPAC name is 1-(2-tert-butylsulfonylethyl)-2-methyl-3-(7-methyloctyl)guanidine.
| Compound Name | 1-(2-tert-butylsulfonylethyl)-2-methyl-3-(7-methyloctyl)guanidine |
|---|---|
| PubChem CID | 111573707 |
| Molecular Formula | C17H37N3O2S |
| Molecular Weight | 347.57 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | 1-(2-tert-butylsulfonylethyl)-2-methyl-3-(7-methyloctyl)guanidine |
| SMILES | C/N=C(\NCCCCCCC(C)C)NCCS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C17H37N3O2S/c1-15(2)11-9-7-8-10-12-19-16(18-6)20-13-14-23(21,22)17(3,4)5/h15H,7-14H2,1-6H3,(H2,18,19,20) |
| InChIKey | ZBYRNBRMEHEGOL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.57 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|