C20H35N3O2S — CID 111204848
2-methyl-1-(7-methyloctyl)-3-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine (PubChem CID 111204848) has the molecular formula C20H35N3O2S and a molecular weight of 381.59 g/mol. Its IUPAC name is 2-methyl-1-(7-methyloctyl)-3-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine.
| Compound Name | 2-methyl-1-(7-methyloctyl)-3-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111204848 |
| Molecular Formula | C20H35N3O2S |
| Molecular Weight | 381.59 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 2-methyl-1-(7-methyloctyl)-3-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCCCCCCC(C)C)NCc1ccc(CS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H35N3O2S/c1-17(2)9-7-5-6-8-14-22-20(21-3)23-15-18-10-12-19(13-11-18)16-26(4,24)25/h10-13,17H,5-9,14-16H2,1-4H3,(H2,21,22,23) |
| InChIKey | OPPHBDYCXLZXON-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.59 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|