C14H23N3O2S — CID 111127340
2-methyl-1-[[4-(methylsulfonylmethyl)phenyl]methyl]-3-propan-2-ylguanidine (PubChem CID 111127340) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is 2-methyl-1-[[4-(methylsulfonylmethyl)phenyl]methyl]-3-propan-2-ylguanidine.
| Compound Name | 2-methyl-1-[[4-(methylsulfonylmethyl)phenyl]methyl]-3-propan-2-ylguanidine |
|---|---|
| PubChem CID | 111127340 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-methyl-1-[[4-(methylsulfonylmethyl)phenyl]methyl]-3-propan-2-ylguanidine |
| SMILES | C/N=C(/NCc1ccc(CS(C)(=O)=O)cc1)NC(C)C |
| InChI | InChI=1S/C14H23N3O2S/c1-11(2)17-14(15-3)16-9-12-5-7-13(8-6-12)10-20(4,18)19/h5-8,11H,9-10H2,1-4H3,(H2,15,16,17) |
| InChIKey | IBJXYSWRJRQRDA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|