C26H32IN3O2S — CID 111233814
1-(3,3-diphenylpropyl)-2-methyl-3-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111233814) has the molecular formula C26H32IN3O2S and a molecular weight of 577.53 g/mol. Its IUPAC name is 1-(3,3-diphenylpropyl)-2-methyl-3-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3,3-diphenylpropyl)-2-methyl-3-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111233814 |
| Molecular Formula | C26H32IN3O2S |
| Molecular Weight | 577.53 g/mol |
| Exact Mass | 577.13 |
| IUPAC Name | 1-(3,3-diphenylpropyl)-2-methyl-3-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(c1ccccc1)c1ccccc1)NCc1ccc(CS(C)(=O)=O)cc1.I |
| InChI | InChI=1S/C26H31N3O2S.HI/c1-27-26(29-19-21-13-15-22(16-14-21)20-32(2,30)31)28-18-17-25(23-9-5-3-6-10-23)24-11-7-4-8-12-24;/h3-16,25H,17-20H2,1-2H3,(H2,27,28,29);1H |
| InChIKey | OEQOAVNMSKBXTP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|