C20H35N3O3S — CID 111715939
1-[3-(benzenesulfonyl)propyl]-2-(2,2-diethyl-4-hydroxybutyl)-3-ethylguanidine (PubChem CID 111715939) has the molecular formula C20H35N3O3S and a molecular weight of 397.59 g/mol. Its IUPAC name is 1-[3-(benzenesulfonyl)propyl]-2-(2,2-diethyl-4-hydroxybutyl)-3-ethylguanidine.
| Compound Name | 1-[3-(benzenesulfonyl)propyl]-2-(2,2-diethyl-4-hydroxybutyl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111715939 |
| Molecular Formula | C20H35N3O3S |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 1-[3-(benzenesulfonyl)propyl]-2-(2,2-diethyl-4-hydroxybutyl)-3-ethylguanidine |
| SMILES | CCN/C(=N\CC(CC)(CC)CCO)NCCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H35N3O3S/c1-4-20(5-2,13-15-24)17-23-19(21-6-3)22-14-10-16-27(25,26)18-11-8-7-9-12-18/h7-9,11-12,24H,4-6,10,13-17H2,1-3H3,(H2,21,22,23) |
| InChIKey | ANWIIXJIXXWXEH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|