C19H33N3O — CID 111546039
1-benzyl-2-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-1-methylguanidine (PubChem CID 111546039) has the molecular formula C19H33N3O and a molecular weight of 319.49 g/mol. Its IUPAC name is 1-benzyl-2-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-1-methylguanidine.
| Compound Name | 1-benzyl-2-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-1-methylguanidine |
|---|---|
| PubChem CID | 111546039 |
| Molecular Formula | C19H33N3O |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.26 |
| IUPAC Name | 1-benzyl-2-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-1-methylguanidine |
| SMILES | CCN/C(=N\CC(CC)(CC)CCO)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C19H33N3O/c1-5-19(6-2,13-14-23)16-21-18(20-7-3)22(4)15-17-11-9-8-10-12-17/h8-12,23H,5-7,13-16H2,1-4H3,(H,20,21) |
| InChIKey | FHBUEESLKLCPBA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|