C26H34IN5O — CID 111974401
1-ethyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]-2-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 111974401) has the molecular formula C26H34IN5O and a molecular weight of 559.50 g/mol. Its IUPAC name is 1-ethyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]-2-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]-2-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111974401 |
| Molecular Formula | C26H34IN5O |
| Molecular Weight | 559.50 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | 1-ethyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]-2-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1CN1CCCC1=O)NCCc1c[nH]c2cc(C)ccc12.I |
| InChI | InChI=1S/C26H33N5O.HI/c1-3-27-26(28-13-12-21-17-29-24-15-19(2)10-11-23(21)24)30-16-20-7-4-5-8-22(20)18-31-14-6-9-25(31)32;/h4-5,7-8,10-11,15,17,29H,3,6,9,12-14,16,18H2,1-2H3,(H2,27,28,30);1H |
| InChIKey | PJRUNYKYCSEEPW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|