C20H32N2O — CID 133199627
3-(3,4-dimethylphenyl)-N-[3-(3-methylpiperidin-1-yl)propyl]propanamide (PubChem CID 133199627) has the molecular formula C20H32N2O and a molecular weight of 316.49 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-N-[3-(3-methylpiperidin-1-yl)propyl]propanamide.
| Compound Name | 3-(3,4-dimethylphenyl)-N-[3-(3-methylpiperidin-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 133199627 |
| Molecular Formula | C20H32N2O |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.25 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-N-[3-(3-methylpiperidin-1-yl)propyl]propanamide |
| SMILES | Cc1ccc(CCC(=O)NCCCN2CCCC(C)C2)cc1C |
| InChI | InChI=1S/C20H32N2O/c1-16-6-4-12-22(15-16)13-5-11-21-20(23)10-9-19-8-7-17(2)18(3)14-19/h7-8,14,16H,4-6,9-13,15H2,1-3H3,(H,21,23) |
| InChIKey | QMRLFIRUHNYJSB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|