C15H18ClF3N2O4S — CID 2912776
2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 2912776) has the molecular formula C15H18ClF3N2O4S and a molecular weight of 414.83 g/mol. Its IUPAC name is 2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 2912776 |
| Molecular Formula | C15H18ClF3N2O4S |
| Molecular Weight | 414.83 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NCC1CCCO1)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C15H18ClF3N2O4S/c1-26(23,24)21(9-14(22)20-8-11-3-2-6-25-11)13-7-10(15(17,18)19)4-5-12(13)16/h4-5,7,11H,2-3,6,8-9H2,1H3,(H,20,22) |
| InChIKey | OTZYNWVBDXNSOY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.83 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |