C22H29FN2O3S2 — CID 30219454
N-[3-[(2-fluorophenyl)methylsulfanyl]propyl]-2-(N-methylsulfonyl-4-propan-2-ylanilino)acetamide (PubChem CID 30219454) has the molecular formula C22H29FN2O3S2 and a molecular weight of 452.62 g/mol. Its IUPAC name is N-[3-[(2-fluorophenyl)methylsulfanyl]propyl]-2-(N-methylsulfonyl-4-propan-2-ylanilino)acetamide.
| Compound Name | N-[3-[(2-fluorophenyl)methylsulfanyl]propyl]-2-(N-methylsulfonyl-4-propan-2-ylanilino)acetamide |
|---|---|
| PubChem CID | 30219454 |
| Molecular Formula | C22H29FN2O3S2 |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | N-[3-[(2-fluorophenyl)methylsulfanyl]propyl]-2-(N-methylsulfonyl-4-propan-2-ylanilino)acetamide |
| SMILES | CC(C)c1ccc(N(CC(=O)NCCCSCc2ccccc2F)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C22H29FN2O3S2/c1-17(2)18-9-11-20(12-10-18)25(30(3,27)28)15-22(26)24-13-6-14-29-16-19-7-4-5-8-21(19)23/h4-5,7-12,17H,6,13-16H2,1-3H3,(H,24,26) |
| InChIKey | DSHHEAZLHZUEPC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|