C22H22Cl2N2O4S2 — CID 30242826
2-(3-chloro-N-(4-chlorophenyl)sulfonylanilino)-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide (PubChem CID 30242826) has the molecular formula C22H22Cl2N2O4S2 and a molecular weight of 513.47 g/mol. Its IUPAC name is 2-(3-chloro-N-(4-chlorophenyl)sulfonylanilino)-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide.
| Compound Name | 2-(3-chloro-N-(4-chlorophenyl)sulfonylanilino)-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide |
|---|---|
| PubChem CID | 30242826 |
| Molecular Formula | C22H22Cl2N2O4S2 |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 512.04 |
| IUPAC Name | 2-(3-chloro-N-(4-chlorophenyl)sulfonylanilino)-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide |
| SMILES | O=C(CN(c1cccc(Cl)c1)S(=O)(=O)c1ccc(Cl)cc1)NCCCSCc1ccco1 |
| InChI | InChI=1S/C22H22Cl2N2O4S2/c23-17-7-9-21(10-8-17)32(28,29)26(19-5-1-4-18(24)14-19)15-22(27)25-11-3-13-31-16-20-6-2-12-30-20/h1-2,4-10,12,14H,3,11,13,15-16H2,(H,25,27) |
| InChIKey | QOEGJAIFCLOYEB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|